C24H48N2O4 — CID 145408102
7-methyl-N-[6-[(7-methyl-6-oxooctanoyl)amino]hexyl]-6-oxooctanamide;molecular hydrogen (PubChem CID 145408102) has the molecular formula C24H48N2O4 and a molecular weight of 428.66 g/mol. Its IUPAC name is 7-methyl-N-[6-[(7-methyl-6-oxooctanoyl)amino]hexyl]-6-oxooctanamide;molecular hydrogen.
| Compound Name | 7-methyl-N-[6-[(7-methyl-6-oxooctanoyl)amino]hexyl]-6-oxooctanamide;molecular hydrogen |
|---|---|
| PubChem CID | 145408102 |
| Molecular Formula | C24H48N2O4 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.36 |
| IUPAC Name | 7-methyl-N-[6-[(7-methyl-6-oxooctanoyl)amino]hexyl]-6-oxooctanamide;molecular hydrogen |
| SMILES | CC(C)C(=O)CCCCC(=O)NCCCCCCNC(=O)CCCCC(=O)C(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C24H44N2O4.2H2/c1-19(2)21(27)13-7-9-15-23(29)25-17-11-5-6-12-18-26-24(30)16-10-8-14-22(28)20(3)4;;/h19-20H,5-18H2,1-4H3,(H,25,29)(H,26,30);2*1H |
| InChIKey | YRYFHSDIEZDNRS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|