About S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate
S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate (PubChem CID 137425861) has the molecular formula C16H29NO3S
and a molecular weight of 315.48 g/mol. Its IUPAC name is S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate.
Molecular Properties
| Compound Name | S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate |
| PubChem CID | 137425861 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate |
| SMILES | CSC(=O)CCCCCNC(=O)CCCCC(=O)C(C)C |
| InChI | InChI=1S/C16H29NO3S/c1-13(2)14(18)9-6-7-10-15(19)17-12-8-4-5-11-16(20)21-3/h13H,4-12H2,1-3H3,(H,17,19) |
| InChIKey | GXMHYLDVUKQQIL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate?
The IUPAC name of S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate (CID 137425861) is S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate.
What is the SMILES notation for S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate?
The canonical SMILES for S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate is CSC(=O)CCCCCNC(=O)CCCCC(=O)C(C)C.
What is the InChIKey of S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate?
The InChIKey is GXMHYLDVUKQQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3S/c1-13(2)14(18)9-6-7-10-15(19)17-12-8-4-5-11-16(20)21-3/h13H,4-12H2,1-3H3,(H,17,19).
What are the key properties of S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate?
S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate has a molecular weight of 315.48 g/mol, XLogP of 3.34, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 6-[(7-methyl-6-oxooctanoyl)amino]hexanethioate is sourced from PubChem (CID 137425861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).