C12H21NO3S — CID 166897496
S-methyl 6-[(3-methyl-2-oxobutyl)amino]-6-oxohexanethioate (PubChem CID 166897496) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is S-methyl 6-[(3-methyl-2-oxobutyl)amino]-6-oxohexanethioate.
| Compound Name | S-methyl 6-[(3-methyl-2-oxobutyl)amino]-6-oxohexanethioate |
|---|---|
| PubChem CID | 166897496 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | S-methyl 6-[(3-methyl-2-oxobutyl)amino]-6-oxohexanethioate |
| SMILES | CSC(=O)CCCCC(=O)NCC(=O)C(C)C |
| InChI | InChI=1S/C12H21NO3S/c1-9(2)10(14)8-13-11(15)6-4-5-7-12(16)17-3/h9H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | IBIUPTRLDBRBDD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|