C9H15NO3S — CID 146619598
4-[(3-methyl-2-oxobutyl)amino]-4-oxobutanethioic S-acid (PubChem CID 146619598) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 4-[(3-methyl-2-oxobutyl)amino]-4-oxobutanethioic S-acid.
| Compound Name | 4-[(3-methyl-2-oxobutyl)amino]-4-oxobutanethioic S-acid |
|---|---|
| PubChem CID | 146619598 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 4-[(3-methyl-2-oxobutyl)amino]-4-oxobutanethioic S-acid |
| SMILES | CC(C)C(=O)CNC(=O)CCC(=O)S |
| InChI | InChI=1S/C9H15NO3S/c1-6(2)7(11)5-10-8(12)3-4-9(13)14/h6H,3-5H2,1-2H3,(H,10,12)(H,13,14) |
| InChIKey | WCEAGCFMDPWCLM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|