C17H36N2O2 — CID 144918108
6-methyl-N-(3-methyl-2-oxobutyl)octanamide;propan-1-amine (PubChem CID 144918108) has the molecular formula C17H36N2O2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 6-methyl-N-(3-methyl-2-oxobutyl)octanamide;propan-1-amine.
| Compound Name | 6-methyl-N-(3-methyl-2-oxobutyl)octanamide;propan-1-amine |
|---|---|
| PubChem CID | 144918108 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 6-methyl-N-(3-methyl-2-oxobutyl)octanamide;propan-1-amine |
| SMILES | CCC(C)CCCCC(=O)NCC(=O)C(C)C.CCCN |
| InChI | InChI=1S/C14H27NO2.C3H9N/c1-5-12(4)8-6-7-9-14(17)15-10-13(16)11(2)3;1-2-3-4/h11-12H,5-10H2,1-4H3,(H,15,17);2-4H2,1H3 |
| InChIKey | HNBDQSDUERWXPN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|