C19H33N3O7 — CID 88647899
5-amino-2-[2-[[(4R)-4-carboxy-4-(heptanoylamino)butanoyl]amino]acetyl]pentanoic acid (PubChem CID 88647899) has the molecular formula C19H33N3O7 and a molecular weight of 415.49 g/mol. Its IUPAC name is 5-amino-2-[2-[[(4R)-4-carboxy-4-(heptanoylamino)butanoyl]amino]acetyl]pentanoic acid.
| Compound Name | 5-amino-2-[2-[[(4R)-4-carboxy-4-(heptanoylamino)butanoyl]amino]acetyl]pentanoic acid |
|---|---|
| PubChem CID | 88647899 |
| Molecular Formula | C19H33N3O7 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 5-amino-2-[2-[[(4R)-4-carboxy-4-(heptanoylamino)butanoyl]amino]acetyl]pentanoic acid |
| SMILES | CCCCCCC(=O)N[C@H](CCC(=O)NCC(=O)C(CCCN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H33N3O7/c1-2-3-4-5-8-17(25)22-14(19(28)29)9-10-16(24)21-12-15(23)13(18(26)27)7-6-11-20/h13-14H,2-12,20H2,1H3,(H,21,24)(H,22,25)(H,26,27)(H,28,29)/t13?,14-/m1/s1 |
| InChIKey | WCKGTJCWTFSGNY-ARLHGKGLSA-N |
| XLogP | 0.43 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|