About butane;3-methyloctane;bis(propan-1-amine)
butane;3-methyloctane;bis(propan-1-amine) (PubChem CID 169237271) has the molecular formula C19H48N2
and a molecular weight of 304.61 g/mol. Its IUPAC name is butane;3-methyloctane;bis(propan-1-amine).
Molecular Properties
| Compound Name | butane;3-methyloctane;bis(propan-1-amine) |
| PubChem CID | 169237271 |
| Molecular Formula | C19H48N2 |
| Molecular Weight | 304.61 g/mol |
| Exact Mass | 304.38 |
| IUPAC Name | butane;3-methyloctane;bis(propan-1-amine) |
| SMILES | CCCC.CCCCCC(C)CC.CCCN.CCCN |
| InChI | InChI=1S/C9H20.C4H10.2C3H9N/c1-4-6-7-8-9(3)5-2;1-3-4-2;2*1-2-3-4/h9H,4-8H2,1-3H3;3-4H2,1-2H3;2*2-4H2,1H3 |
| InChIKey | CKRSKXJLKSFTBP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;3-methyloctane;bis(propan-1-amine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;3-methyloctane;bis(propan-1-amine)?
The IUPAC name of butane;3-methyloctane;bis(propan-1-amine) (CID 169237271) is butane;3-methyloctane;bis(propan-1-amine).
What is the SMILES notation for butane;3-methyloctane;bis(propan-1-amine)?
The canonical SMILES for butane;3-methyloctane;bis(propan-1-amine) is CCCC.CCCCCC(C)CC.CCCN.CCCN.
What is the InChIKey of butane;3-methyloctane;bis(propan-1-amine)?
The InChIKey is CKRSKXJLKSFTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C4H10.2C3H9N/c1-4-6-7-8-9(3)5-2;1-3-4-2;2*1-2-3-4/h9H,4-8H2,1-3H3;3-4H2,1-2H3;2*2-4H2,1H3.
What are the key properties of butane;3-methyloctane;bis(propan-1-amine)?
butane;3-methyloctane;bis(propan-1-amine) has a molecular weight of 304.61 g/mol, XLogP of 6.13, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;3-methyloctane;bis(propan-1-amine) is sourced from PubChem (CID 169237271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).