C15H34N4O2 — CID 171639588
3-amino-N-[2-(5-methylhexylamino)-2-oxoethyl]propanamide;propan-1-amine (PubChem CID 171639588) has the molecular formula C15H34N4O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3-amino-N-[2-(5-methylhexylamino)-2-oxoethyl]propanamide;propan-1-amine.
| Compound Name | 3-amino-N-[2-(5-methylhexylamino)-2-oxoethyl]propanamide;propan-1-amine |
|---|---|
| PubChem CID | 171639588 |
| Molecular Formula | C15H34N4O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 3-amino-N-[2-(5-methylhexylamino)-2-oxoethyl]propanamide;propan-1-amine |
| SMILES | CC(C)CCCCNC(=O)CNC(=O)CCN.CCCN |
| InChI | InChI=1S/C12H25N3O2.C3H9N/c1-10(2)5-3-4-8-14-12(17)9-15-11(16)6-7-13;1-2-3-4/h10H,3-9,13H2,1-2H3,(H,14,17)(H,15,16);2-4H2,1H3 |
| InChIKey | SVMAZXIOCFVQGX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|