C13H33N3OS2 — CID 168896262
2-aminoethanethiol;4-methyl-N-(2-sulfanylethyl)pentanamide;propan-1-amine (PubChem CID 168896262) has the molecular formula C13H33N3OS2 and a molecular weight of 311.56 g/mol. Its IUPAC name is 2-aminoethanethiol;4-methyl-N-(2-sulfanylethyl)pentanamide;propan-1-amine.
| Compound Name | 2-aminoethanethiol;4-methyl-N-(2-sulfanylethyl)pentanamide;propan-1-amine |
|---|---|
| PubChem CID | 168896262 |
| Molecular Formula | C13H33N3OS2 |
| Molecular Weight | 311.56 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 2-aminoethanethiol;4-methyl-N-(2-sulfanylethyl)pentanamide;propan-1-amine |
| SMILES | CC(C)CCC(=O)NCCS.CCCN.NCCS |
| InChI | InChI=1S/C8H17NOS.C3H9N.C2H7NS/c1-7(2)3-4-8(10)9-5-6-11;1-2-3-4;3-1-2-4/h7,11H,3-6H2,1-2H3,(H,9,10);2-4H2,1H3;4H,1-3H2 |
| InChIKey | LODZJYDYKUEJBT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.56 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|