C8H20N2O — CID 143117924
N-(2-aminoethyl)butanamide;ethane (PubChem CID 143117924) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is N-(2-aminoethyl)butanamide;ethane.
| Compound Name | N-(2-aminoethyl)butanamide;ethane |
|---|---|
| PubChem CID | 143117924 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | N-(2-aminoethyl)butanamide;ethane |
| SMILES | CC.CCCC(=O)NCCN |
| InChI | InChI=1S/C6H14N2O.C2H6/c1-2-3-6(9)8-5-4-7;1-2/h2-5,7H2,1H3,(H,8,9);1-2H3 |
| InChIKey | MCWAIMLOUNBBCQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |