C17H36N2O — CID 65292309
6-amino-4,4-dimethyl-N-(7-methyloctyl)hexanamide (PubChem CID 65292309) has the molecular formula C17H36N2O and a molecular weight of 284.49 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-N-(7-methyloctyl)hexanamide.
| Compound Name | 6-amino-4,4-dimethyl-N-(7-methyloctyl)hexanamide |
|---|---|
| PubChem CID | 65292309 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 6-amino-4,4-dimethyl-N-(7-methyloctyl)hexanamide |
| SMILES | CC(C)CCCCCCNC(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C17H36N2O/c1-15(2)9-7-5-6-8-14-19-16(20)10-11-17(3,4)12-13-18/h15H,5-14,18H2,1-4H3,(H,19,20) |
| InChIKey | QBKWCSQFUCJXNC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|