C14H26N2O — CID 106213131
6-amino-N-hex-5-ynyl-4,4-dimethylhexanamide (PubChem CID 106213131) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 6-amino-N-hex-5-ynyl-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-hex-5-ynyl-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 106213131 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 6-amino-N-hex-5-ynyl-4,4-dimethylhexanamide |
| SMILES | C#CCCCCNC(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C14H26N2O/c1-4-5-6-7-12-16-13(17)8-9-14(2,3)10-11-15/h1H,5-12,15H2,2-3H3,(H,16,17) |
| InChIKey | FYIKZVXCIWPKEP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|