C22H41N3O — CID 145163611
(Z)-N-(3,3-diaminobutyl)octadec-9-en-17-ynamide (PubChem CID 145163611) has the molecular formula C22H41N3O and a molecular weight of 363.59 g/mol. Its IUPAC name is (Z)-N-(3,3-diaminobutyl)octadec-9-en-17-ynamide.
| Compound Name | (Z)-N-(3,3-diaminobutyl)octadec-9-en-17-ynamide |
|---|---|
| PubChem CID | 145163611 |
| Molecular Formula | C22H41N3O |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.32 |
| IUPAC Name | (Z)-N-(3,3-diaminobutyl)octadec-9-en-17-ynamide |
| SMILES | C#CCCCCCC/C=C\CCCCCCCC(=O)NCCC(C)(N)N |
| InChI | InChI=1S/C22H41N3O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(26)25-20-19-22(2,23)24/h1,10-11H,4-9,12-20,23-24H2,2H3,(H,25,26)/b11-10- |
| InChIKey | FIXMBWMLNGLWNP-KHPPLWFESA-N |
| XLogP | 4.39 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|