C28H48N2O2 — CID 143956023
N,N'-bis(prop-2-ynyl)icos-10-enediamide;ethane (PubChem CID 143956023) has the molecular formula C28H48N2O2 and a molecular weight of 444.70 g/mol. Its IUPAC name is N,N'-bis(prop-2-ynyl)icos-10-enediamide;ethane.
| Compound Name | N,N'-bis(prop-2-ynyl)icos-10-enediamide;ethane |
|---|---|
| PubChem CID | 143956023 |
| Molecular Formula | C28H48N2O2 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.37 |
| IUPAC Name | N,N'-bis(prop-2-ynyl)icos-10-enediamide;ethane |
| SMILES | C#CCNC(=O)CCCCCCCCC=CCCCCCCCCC(=O)NCC#C.CC |
| InChI | InChI=1S/C26H42N2O2.C2H6/c1-3-23-27-25(29)21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-26(30)28-24-4-2;1-2/h1-2,5-6H,7-24H2,(H,27,29)(H,28,30);1-2H3 |
| InChIKey | MNIWFWKRKBJAQP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|