C24H38N2O2 — CID 90949780
N,N'-bis(prop-2-ynyl)octadec-9-enediamide (PubChem CID 90949780) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is N,N'-bis(prop-2-ynyl)octadec-9-enediamide.
| Compound Name | N,N'-bis(prop-2-ynyl)octadec-9-enediamide |
|---|---|
| PubChem CID | 90949780 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | N,N'-bis(prop-2-ynyl)octadec-9-enediamide |
| SMILES | C#CCNC(=O)CCCCCCCC=CCCCCCCCC(=O)NCC#C |
| InChI | InChI=1S/C24H38N2O2/c1-3-21-25-23(27)19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-24(28)26-22-4-2/h1-2,5-6H,7-22H2,(H,25,27)(H,26,28) |
| InChIKey | HZPJBEBTIVEXHZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|