C14H30N2O2 — CID 107842588
6-amino-N-(6-hydroxyhexyl)-4,4-dimethylhexanamide (PubChem CID 107842588) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 6-amino-N-(6-hydroxyhexyl)-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-(6-hydroxyhexyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 107842588 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 6-amino-N-(6-hydroxyhexyl)-4,4-dimethylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)NCCCCCCO |
| InChI | InChI=1S/C14H30N2O2/c1-14(2,9-10-15)8-7-13(18)16-11-5-3-4-6-12-17/h17H,3-12,15H2,1-2H3,(H,16,18) |
| InChIKey | FBRLWLFYSDQNNQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|