C25H51N3O5 — CID 170149149
N'-[3-[4-(5-amino-2-methylpentan-2-yl)oxy-2-methylbutan-2-yl]oxypropyl]-N-(7-hydroxyheptyl)butanediamide (PubChem CID 170149149) has the molecular formula C25H51N3O5 and a molecular weight of 473.70 g/mol. Its IUPAC name is N'-[3-[4-(5-amino-2-methylpentan-2-yl)oxy-2-methylbutan-2-yl]oxypropyl]-N-(7-hydroxyheptyl)butanediamide.
| Compound Name | N'-[3-[4-(5-amino-2-methylpentan-2-yl)oxy-2-methylbutan-2-yl]oxypropyl]-N-(7-hydroxyheptyl)butanediamide |
|---|---|
| PubChem CID | 170149149 |
| Molecular Formula | C25H51N3O5 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.38 |
| IUPAC Name | N'-[3-[4-(5-amino-2-methylpentan-2-yl)oxy-2-methylbutan-2-yl]oxypropyl]-N-(7-hydroxyheptyl)butanediamide |
| SMILES | CC(C)(CCCN)OCCC(C)(C)OCCCNC(=O)CCC(=O)NCCCCCCCO |
| InChI | InChI=1S/C25H51N3O5/c1-24(2,14-10-16-26)33-21-15-25(3,4)32-20-11-18-28-23(31)13-12-22(30)27-17-8-6-5-7-9-19-29/h29H,5-21,26H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | YXWDBVSEUXQEPE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|