C21H42N2O6 — CID 142997826
tert-butyl N-[4-[[4-(3-methoxy-3-methylbutoxy)-4-methylpentanoyl]amino]butoxy]carbamate (PubChem CID 142997826) has the molecular formula C21H42N2O6 and a molecular weight of 418.58 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-(3-methoxy-3-methylbutoxy)-4-methylpentanoyl]amino]butoxy]carbamate.
| Compound Name | tert-butyl N-[4-[[4-(3-methoxy-3-methylbutoxy)-4-methylpentanoyl]amino]butoxy]carbamate |
|---|---|
| PubChem CID | 142997826 |
| Molecular Formula | C21H42N2O6 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | tert-butyl N-[4-[[4-(3-methoxy-3-methylbutoxy)-4-methylpentanoyl]amino]butoxy]carbamate |
| SMILES | COC(C)(C)CCOC(C)(C)CCC(=O)NCCCCONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H42N2O6/c1-19(2,3)29-18(25)23-28-15-10-9-14-22-17(24)11-12-21(6,7)27-16-13-20(4,5)26-8/h9-16H2,1-8H3,(H,22,24)(H,23,25) |
| InChIKey | VVQZQWPFIVEPCW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|