C16H32O4 — CID 88982761
tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate (PubChem CID 88982761) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate.
| Compound Name | tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate |
|---|---|
| PubChem CID | 88982761 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate |
| SMILES | COC(C)(C)CCOC(C)(C)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32O4/c1-14(2,3)20-13(17)9-10-16(6,7)19-12-11-15(4,5)18-8/h9-12H2,1-8H3 |
| InChIKey | JDHBRNLOLNUIDL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |