tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate

C16H32O4 — CID 88982761

IUPACtert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate
SMILESCOC(C)(C)CCOC(C)(C)CCC(=O)OC(C)(C)C
InChIInChI=1S/C16H32O4/c1-14(2,3)20-13(17)9-10-16(6,7)19-12-11-15(4,5)18-8/h9-12H2,1-8H3
InChIKeyJDHBRNLOLNUIDL-UHFFFAOYSA-N
MW288.43 g/mol
LogP3.72
Rot. Bonds8

About tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate

tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate (PubChem CID 88982761) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate.

Molecular Properties

Compound Nametert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate
PubChem CID88982761
Molecular FormulaC16H32O4
Molecular Weight288.43 g/mol
Exact Mass288.23
IUPAC Nametert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate
SMILESCOC(C)(C)CCOC(C)(C)CCC(=O)OC(C)(C)C
InChIInChI=1S/C16H32O4/c1-14(2,3)20-13(17)9-10-16(6,7)19-12-11-15(4,5)18-8/h9-12H2,1-8H3
InChIKeyJDHBRNLOLNUIDL-UHFFFAOYSA-N
XLogP3.72
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.43
LogP ≤ 53.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
The IUPAC name of tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate (CID 88982761) is tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate.
What is the SMILES notation for tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
The canonical SMILES for tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate is COC(C)(C)CCOC(C)(C)CCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
The InChIKey is JDHBRNLOLNUIDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O4/c1-14(2,3)20-13(17)9-10-16(6,7)19-12-11-15(4,5)18-8/h9-12H2,1-8H3.
What are the key properties of tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate?
tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate has a molecular weight of 288.43 g/mol, XLogP of 3.72, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(3-methoxy-3-methylbutoxy)-4-methylpentanoate is sourced from PubChem (CID 88982761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).