C17H39NO4 — CID 143339482
ethane;[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] N-methylcarbamate (PubChem CID 143339482) has the molecular formula C17H39NO4 and a molecular weight of 321.50 g/mol. Its IUPAC name is ethane;[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] N-methylcarbamate.
| Compound Name | ethane;[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] N-methylcarbamate |
|---|---|
| PubChem CID | 143339482 |
| Molecular Formula | C17H39NO4 |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.29 |
| IUPAC Name | ethane;[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] N-methylcarbamate |
| SMILES | CC.CC.CNC(=O)OCCC(C)(C)OCCC(C)(C)OC |
| InChI | InChI=1S/C13H27NO4.2C2H6/c1-12(2,16-6)8-10-18-13(3,4)7-9-17-11(15)14-5;2*1-2/h7-10H2,1-6H3,(H,14,15);2*1-2H3 |
| InChIKey | KMHOQVBSGDOSAT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |