C13H25NO5 — CID 118407791
[2-(3-methoxy-3-methylbutoxy)-2-methylpropyl]carbamoyl acetate (PubChem CID 118407791) has the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. Its IUPAC name is [2-(3-methoxy-3-methylbutoxy)-2-methylpropyl]carbamoyl acetate.
| Compound Name | [2-(3-methoxy-3-methylbutoxy)-2-methylpropyl]carbamoyl acetate |
|---|---|
| PubChem CID | 118407791 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | [2-(3-methoxy-3-methylbutoxy)-2-methylpropyl]carbamoyl acetate |
| SMILES | COC(C)(C)CCOC(C)(C)CNC(=O)OC(C)=O |
| InChI | InChI=1S/C13H25NO5/c1-10(15)19-11(16)14-9-13(4,5)18-8-7-12(2,3)17-6/h7-9H2,1-6H3,(H,14,16) |
| InChIKey | CEKPPUZPCZCDLB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|