C11H21F2NO3 — CID 166716428
N-[2-[3-(fluoromethoxy)-3-methylbutoxy]-2-methylpropyl]carbamoyl fluoride (PubChem CID 166716428) has the molecular formula C11H21F2NO3 and a molecular weight of 253.29 g/mol. Its IUPAC name is N-[2-[3-(fluoromethoxy)-3-methylbutoxy]-2-methylpropyl]carbamoyl fluoride.
| Compound Name | N-[2-[3-(fluoromethoxy)-3-methylbutoxy]-2-methylpropyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 166716428 |
| Molecular Formula | C11H21F2NO3 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-[2-[3-(fluoromethoxy)-3-methylbutoxy]-2-methylpropyl]carbamoyl fluoride |
| SMILES | CC(C)(CCOC(C)(C)CNC(=O)F)OCF |
| InChI | InChI=1S/C11H21F2NO3/c1-10(2,17-8-12)5-6-16-11(3,4)7-14-9(13)15/h5-8H2,1-4H3,(H,14,15) |
| InChIKey | SOZTWXKLXCMZKM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|