C13H25NO3 — CID 147135875
N-[2-(3,3-dimethyl-4-oxopentoxy)-2-methylpropyl]acetamide (PubChem CID 147135875) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[2-(3,3-dimethyl-4-oxopentoxy)-2-methylpropyl]acetamide.
| Compound Name | N-[2-(3,3-dimethyl-4-oxopentoxy)-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 147135875 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-[2-(3,3-dimethyl-4-oxopentoxy)-2-methylpropyl]acetamide |
| SMILES | CC(=O)NCC(C)(C)OCCC(C)(C)C(C)=O |
| InChI | InChI=1S/C13H25NO3/c1-10(15)12(3,4)7-8-17-13(5,6)9-14-11(2)16/h7-9H2,1-6H3,(H,14,16) |
| InChIKey | BRDONGQZOWDGIR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |