C17H28N2O4 — CID 154677980
N-[2-(4-amino-3,3-dimethyl-4-oxobutoxy)-2-methylpropyl]-4-oxohept-5-ynamide (PubChem CID 154677980) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[2-(4-amino-3,3-dimethyl-4-oxobutoxy)-2-methylpropyl]-4-oxohept-5-ynamide.
| Compound Name | N-[2-(4-amino-3,3-dimethyl-4-oxobutoxy)-2-methylpropyl]-4-oxohept-5-ynamide |
|---|---|
| PubChem CID | 154677980 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[2-(4-amino-3,3-dimethyl-4-oxobutoxy)-2-methylpropyl]-4-oxohept-5-ynamide |
| SMILES | CC#CC(=O)CCC(=O)NCC(C)(C)OCCC(C)(C)C(N)=O |
| InChI | InChI=1S/C17H28N2O4/c1-6-7-13(20)8-9-14(21)19-12-17(4,5)23-11-10-16(2,3)15(18)22/h8-12H2,1-5H3,(H2,18,22)(H,19,21) |
| InChIKey | AXIIGQAUEUYNFO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|