C24H48N2O4S2 — CID 146510269
N-[2-methyl-2-(3-methylbutoxy)propyl]-3-[[3-[[2-methyl-2-(3-methylbutoxy)propyl]amino]-3-oxopropyl]disulfanyl]propanamide (PubChem CID 146510269) has the molecular formula C24H48N2O4S2 and a molecular weight of 492.79 g/mol. Its IUPAC name is N-[2-methyl-2-(3-methylbutoxy)propyl]-3-[[3-[[2-methyl-2-(3-methylbutoxy)propyl]amino]-3-oxopropyl]disulfanyl]propanamide.
| Compound Name | N-[2-methyl-2-(3-methylbutoxy)propyl]-3-[[3-[[2-methyl-2-(3-methylbutoxy)propyl]amino]-3-oxopropyl]disulfanyl]propanamide |
|---|---|
| PubChem CID | 146510269 |
| Molecular Formula | C24H48N2O4S2 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | N-[2-methyl-2-(3-methylbutoxy)propyl]-3-[[3-[[2-methyl-2-(3-methylbutoxy)propyl]amino]-3-oxopropyl]disulfanyl]propanamide |
| SMILES | CC(C)CCOC(C)(C)CNC(=O)CCSSCCC(=O)NCC(C)(C)OCCC(C)C |
| InChI | InChI=1S/C24H48N2O4S2/c1-19(2)9-13-29-23(5,6)17-25-21(27)11-15-31-32-16-12-22(28)26-18-24(7,8)30-14-10-20(3)4/h19-20H,9-18H2,1-8H3,(H,25,27)(H,26,28) |
| InChIKey | YYMKMZOWNFTWOI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|