C20H33NO3 — CID 166663728
[(8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-methyl-2-(3-methylbutoxy)propyl]carbamate (PubChem CID 166663728) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is [(8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-methyl-2-(3-methylbutoxy)propyl]carbamate.
| Compound Name | [(8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-methyl-2-(3-methylbutoxy)propyl]carbamate |
|---|---|
| PubChem CID | 166663728 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | [(8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-methyl-2-(3-methylbutoxy)propyl]carbamate |
| SMILES | CC(C)CCOC(C)(C)CNC(=O)OCC1C2CCC#CCC[C@@H]21 |
| InChI | InChI=1S/C20H33NO3/c1-15(2)11-12-24-20(3,4)14-21-19(22)23-13-18-16-9-7-5-6-8-10-17(16)18/h15-18H,7-14H2,1-4H3,(H,21,22)/t16-,17?,18?/m0/s1 |
| InChIKey | QYROPAAGLARKFH-AOCRQIFASA-N |
| XLogP | 3.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|