C13H27NO2 — CID 147929425
N-[3-methyl-3-(3-methylbutoxy)butyl]propanamide (PubChem CID 147929425) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N-[3-methyl-3-(3-methylbutoxy)butyl]propanamide.
| Compound Name | N-[3-methyl-3-(3-methylbutoxy)butyl]propanamide |
|---|---|
| PubChem CID | 147929425 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-[3-methyl-3-(3-methylbutoxy)butyl]propanamide |
| SMILES | CCC(=O)NCCC(C)(C)OCCC(C)C |
| InChI | InChI=1S/C13H27NO2/c1-6-12(15)14-9-8-13(4,5)16-10-7-11(2)3/h11H,6-10H2,1-5H3,(H,14,15) |
| InChIKey | IJOSGBZYHMUOHP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |