C15H33NO4S2 — CID 178164257
N-[2-(2-hydroxyethyldisulfanyl)ethyl]-3-methyl-3-(3-methylbutoxy)butanamide;methanol (PubChem CID 178164257) has the molecular formula C15H33NO4S2 and a molecular weight of 355.57 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyldisulfanyl)ethyl]-3-methyl-3-(3-methylbutoxy)butanamide;methanol.
| Compound Name | N-[2-(2-hydroxyethyldisulfanyl)ethyl]-3-methyl-3-(3-methylbutoxy)butanamide;methanol |
|---|---|
| PubChem CID | 178164257 |
| Molecular Formula | C15H33NO4S2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[2-(2-hydroxyethyldisulfanyl)ethyl]-3-methyl-3-(3-methylbutoxy)butanamide;methanol |
| SMILES | CC(C)CCOC(C)(C)CC(=O)NCCSSCCO.CO |
| InChI | InChI=1S/C14H29NO3S2.CH4O/c1-12(2)5-8-18-14(3,4)11-13(17)15-6-9-19-20-10-7-16;1-2/h12,16H,5-11H2,1-4H3,(H,15,17);2H,1H3 |
| InChIKey | GTVMZJWQSLFFCM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|