C13H30N2O2 — CID 156868708
methanamine;N-[3-methyl-3-(3-methylbutoxy)butyl]acetamide (PubChem CID 156868708) has the molecular formula C13H30N2O2 and a molecular weight of 246.39 g/mol. Its IUPAC name is methanamine;N-[3-methyl-3-(3-methylbutoxy)butyl]acetamide.
| Compound Name | methanamine;N-[3-methyl-3-(3-methylbutoxy)butyl]acetamide |
|---|---|
| PubChem CID | 156868708 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | methanamine;N-[3-methyl-3-(3-methylbutoxy)butyl]acetamide |
| SMILES | CC(=O)NCCC(C)(C)OCCC(C)C.CN |
| InChI | InChI=1S/C12H25NO2.CH5N/c1-10(2)6-9-15-12(4,5)7-8-13-11(3)14;1-2/h10H,6-9H2,1-5H3,(H,13,14);2H2,1H3 |
| InChIKey | RSDQSHWDMPOYEK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |