C18H38N2O3 — CID 166141093
N-[3-(3-acetamido-3-methylbutoxy)-3-methylbutyl]-2-methylpropanamide;ethane (PubChem CID 166141093) has the molecular formula C18H38N2O3 and a molecular weight of 330.51 g/mol. Its IUPAC name is N-[3-(3-acetamido-3-methylbutoxy)-3-methylbutyl]-2-methylpropanamide;ethane.
| Compound Name | N-[3-(3-acetamido-3-methylbutoxy)-3-methylbutyl]-2-methylpropanamide;ethane |
|---|---|
| PubChem CID | 166141093 |
| Molecular Formula | C18H38N2O3 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | N-[3-(3-acetamido-3-methylbutoxy)-3-methylbutyl]-2-methylpropanamide;ethane |
| SMILES | CC.CC(=O)NC(C)(C)CCOC(C)(C)CCNC(=O)C(C)C |
| InChI | InChI=1S/C16H32N2O3.C2H6/c1-12(2)14(20)17-10-8-16(6,7)21-11-9-15(4,5)18-13(3)19;1-2/h12H,8-11H2,1-7H3,(H,17,20)(H,18,19);1-2H3 |
| InChIKey | YZKKDVHJMPUNPU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |