C17H35NO3 — CID 144786289
2-methyl-N-[3-methyl-3-[2-methyl-2-[(2-methylpropan-2-yl)oxy]propoxy]butyl]propanamide (PubChem CID 144786289) has the molecular formula C17H35NO3 and a molecular weight of 301.47 g/mol. Its IUPAC name is 2-methyl-N-[3-methyl-3-[2-methyl-2-[(2-methylpropan-2-yl)oxy]propoxy]butyl]propanamide.
| Compound Name | 2-methyl-N-[3-methyl-3-[2-methyl-2-[(2-methylpropan-2-yl)oxy]propoxy]butyl]propanamide |
|---|---|
| PubChem CID | 144786289 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 2-methyl-N-[3-methyl-3-[2-methyl-2-[(2-methylpropan-2-yl)oxy]propoxy]butyl]propanamide |
| SMILES | CC(C)C(=O)NCCC(C)(C)OCC(C)(C)OC(C)(C)C |
| InChI | InChI=1S/C17H35NO3/c1-13(2)14(19)18-11-10-16(6,7)20-12-17(8,9)21-15(3,4)5/h13H,10-12H2,1-9H3,(H,18,19) |
| InChIKey | DAPRZEHYLDBKQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |