C17H36N2O3 — CID 174323888
N-[3-(2-ethoxy-2-methylpropoxy)-3-methylbutyl]-2-(methylamino)pentanamide (PubChem CID 174323888) has the molecular formula C17H36N2O3 and a molecular weight of 316.49 g/mol. Its IUPAC name is N-[3-(2-ethoxy-2-methylpropoxy)-3-methylbutyl]-2-(methylamino)pentanamide.
| Compound Name | N-[3-(2-ethoxy-2-methylpropoxy)-3-methylbutyl]-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 174323888 |
| Molecular Formula | C17H36N2O3 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | N-[3-(2-ethoxy-2-methylpropoxy)-3-methylbutyl]-2-(methylamino)pentanamide |
| SMILES | CCCC(NC)C(=O)NCCC(C)(C)OCC(C)(C)OCC |
| InChI | InChI=1S/C17H36N2O3/c1-8-10-14(18-7)15(20)19-12-11-16(3,4)22-13-17(5,6)21-9-2/h14,18H,8-13H2,1-7H3,(H,19,20) |
| InChIKey | HYQSFGZIHMKPDS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |