C14H28BrNO3 — CID 167168575
tert-butyl N-[3-(3-bromobutoxy)-3-methylbutyl]carbamate (PubChem CID 167168575) has the molecular formula C14H28BrNO3 and a molecular weight of 338.29 g/mol. Its IUPAC name is tert-butyl N-[3-(3-bromobutoxy)-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-bromobutoxy)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 167168575 |
| Molecular Formula | C14H28BrNO3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | tert-butyl N-[3-(3-bromobutoxy)-3-methylbutyl]carbamate |
| SMILES | CC(Br)CCOC(C)(C)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28BrNO3/c1-11(15)7-10-18-14(5,6)8-9-16-12(17)19-13(2,3)4/h11H,7-10H2,1-6H3,(H,16,17) |
| InChIKey | AWTFSRUTSHNTLM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|