C16H33NO3 — CID 118409061
tert-butyl N-[3-methyl-3-(3-methylbutoxy)pentyl]carbamate (PubChem CID 118409061) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-3-(3-methylbutoxy)pentyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-3-(3-methylbutoxy)pentyl]carbamate |
|---|---|
| PubChem CID | 118409061 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | tert-butyl N-[3-methyl-3-(3-methylbutoxy)pentyl]carbamate |
| SMILES | CCC(C)(CCNC(=O)OC(C)(C)C)OCCC(C)C |
| InChI | InChI=1S/C16H33NO3/c1-8-16(7,19-12-9-13(2)3)10-11-17-14(18)20-15(4,5)6/h13H,8-12H2,1-7H3,(H,17,18) |
| InChIKey | RZUNWMOWQCQPNI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |