C11H23NO3 — CID 101456179
tert-butyl N-[(4S)-4-hydroxyhexyl]carbamate (PubChem CID 101456179) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-hydroxyhexyl]carbamate.
| Compound Name | tert-butyl N-[(4S)-4-hydroxyhexyl]carbamate |
|---|---|
| PubChem CID | 101456179 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | tert-butyl N-[(4S)-4-hydroxyhexyl]carbamate |
| SMILES | CC[C@H](O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO3/c1-5-9(13)7-6-8-12-10(14)15-11(2,3)4/h9,13H,5-8H2,1-4H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | WZSZNECFTARCBP-VIFPVBQESA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|