C11H21F3N2O3 — CID 92982229
tert-butyl N-[(4S,5S)-4-amino-6,6,6-trifluoro-5-hydroxyhexyl]carbamate (PubChem CID 92982229) has the molecular formula C11H21F3N2O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-4-amino-6,6,6-trifluoro-5-hydroxyhexyl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-4-amino-6,6,6-trifluoro-5-hydroxyhexyl]carbamate |
|---|---|
| PubChem CID | 92982229 |
| Molecular Formula | C11H21F3N2O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | tert-butyl N-[(4S,5S)-4-amino-6,6,6-trifluoro-5-hydroxyhexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](N)[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O3/c1-10(2,3)19-9(18)16-6-4-5-7(15)8(17)11(12,13)14/h7-8,17H,4-6,15H2,1-3H3,(H,16,18)/t7-,8-/m0/s1 |
| InChIKey | UHEFDJGMLCIEND-YUMQZZPRSA-N |
| XLogP | 1.54 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|