C11H22N2O4 — CID 176804186
[(1R)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] formate (PubChem CID 176804186) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(1R)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] formate.
| Compound Name | [(1R)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] formate |
|---|---|
| PubChem CID | 176804186 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | [(1R)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] formate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)OC=O |
| InChI | InChI=1S/C11H22N2O4/c1-11(2,3)17-10(15)13-7-5-4-6-9(12)16-8-14/h8-9H,4-7,12H2,1-3H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | OTLOCPNNDFMNFO-SECBINFHSA-N |
| XLogP | 1.14 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|