C10H21FN2O2 — CID 90126597
tert-butyl N-[(5R)-5-amino-5-fluoropentyl]carbamate (PubChem CID 90126597) has the molecular formula C10H21FN2O2 and a molecular weight of 220.29 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-amino-5-fluoropentyl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-amino-5-fluoropentyl]carbamate |
|---|---|
| PubChem CID | 90126597 |
| Molecular Formula | C10H21FN2O2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | tert-butyl N-[(5R)-5-amino-5-fluoropentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)F |
| InChI | InChI=1S/C10H21FN2O2/c1-10(2,3)15-9(14)13-7-5-4-6-8(11)12/h8H,4-7,12H2,1-3H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | NYYRMUFXVBWGRN-QMMMGPOBSA-N |
| XLogP | 1.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|