C11H24N2O4 — CID 165157652
tert-butyl N-[(5S)-5-amino-6,6-dihydroxyhexyl]carbamate (PubChem CID 165157652) has the molecular formula C11H24N2O4 and a molecular weight of 248.32 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-amino-6,6-dihydroxyhexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-amino-6,6-dihydroxyhexyl]carbamate |
|---|---|
| PubChem CID | 165157652 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | tert-butyl N-[(5S)-5-amino-6,6-dihydroxyhexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)C(O)O |
| InChI | InChI=1S/C11H24N2O4/c1-11(2,3)17-10(16)13-7-5-4-6-8(12)9(14)15/h8-9,14-15H,4-7,12H2,1-3H3,(H,13,16)/t8-/m0/s1 |
| InChIKey | XQUGOWDSGKKAAP-QMMMGPOBSA-N |
| XLogP | 0.32 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|