C9H16N2O5 — CID 89403463
3-[(5-amino-5-formyloxypentyl)amino]-3-oxopropanoic acid (PubChem CID 89403463) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-[(5-amino-5-formyloxypentyl)amino]-3-oxopropanoic acid.
| Compound Name | 3-[(5-amino-5-formyloxypentyl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 89403463 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-[(5-amino-5-formyloxypentyl)amino]-3-oxopropanoic acid |
| SMILES | NC(CCCCNC(=O)CC(=O)O)OC=O |
| InChI | InChI=1S/C9H16N2O5/c10-7(16-6-12)3-1-2-4-11-8(13)5-9(14)15/h6-7H,1-5,10H2,(H,11,13)(H,14,15) |
| InChIKey | GYAQFQFOVVJWBJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|