C10H19N3O3S — CID 89403467
[(1R)-1-amino-5-(1,3-thiazolidine-4-carbonylamino)pentyl] formate (PubChem CID 89403467) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is [(1R)-1-amino-5-(1,3-thiazolidine-4-carbonylamino)pentyl] formate.
| Compound Name | [(1R)-1-amino-5-(1,3-thiazolidine-4-carbonylamino)pentyl] formate |
|---|---|
| PubChem CID | 89403467 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | [(1R)-1-amino-5-(1,3-thiazolidine-4-carbonylamino)pentyl] formate |
| SMILES | N[C@@H](CCCCNC(=O)C1CSCN1)OC=O |
| InChI | InChI=1S/C10H19N3O3S/c11-9(16-7-14)3-1-2-4-12-10(15)8-5-17-6-13-8/h7-9,13H,1-6,11H2,(H,12,15)/t8?,9-/m1/s1 |
| InChIKey | QOFZBYWCHMYERZ-YGPZHTELSA-N |
| XLogP | -0.61 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|