C6H11N3O4S — CID 11775674
2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate (PubChem CID 11775674) has the molecular formula C6H11N3O4S and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate.
| Compound Name | 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate |
|---|---|
| PubChem CID | 11775674 |
| Molecular Formula | C6H11N3O4S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate |
| SMILES | O=C(NCCO[N+](=O)[O-])[C@@H]1CSCN1 |
| InChI | InChI=1S/C6H11N3O4S/c10-6(5-3-14-4-8-5)7-1-2-13-9(11)12/h5,8H,1-4H2,(H,7,10)/t5-/m0/s1 |
| InChIKey | AELJWRSNCNKINT-YFKPBYRVSA-N |
| XLogP | -1.03 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|