C12H17N3O8S — CID 10715944
[(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]acetate (PubChem CID 10715944) has the molecular formula C12H17N3O8S and a molecular weight of 363.35 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]acetate.
| Compound Name | [(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 10715944 |
| Molecular Formula | C12H17N3O8S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]acetate |
| SMILES | O=C(CNC(=O)[C@@H]1CSCN1)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O8S/c16-9(1-13-12(17)6-4-24-5-14-6)22-7-2-20-11-8(23-15(18)19)3-21-10(7)11/h6-8,10-11,14H,1-5H2,(H,13,17)/t6-,7-,8+,10+,11+/m0/s1 |
| InChIKey | PMLKYGWRZDMAKM-WFADCGHZSA-N |
| XLogP | -1.95 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|