C6H11BrN2OS — CID 154729350
N-(2-bromoethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 154729350) has the molecular formula C6H11BrN2OS and a molecular weight of 239.14 g/mol. Its IUPAC name is N-(2-bromoethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-bromoethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 154729350 |
| Molecular Formula | C6H11BrN2OS |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | N-(2-bromoethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCBr)C1CSCN1 |
| InChI | InChI=1S/C6H11BrN2OS/c7-1-2-8-6(10)5-3-11-4-9-5/h5,9H,1-4H2,(H,8,10) |
| InChIKey | FLRFTHIDJXUAHS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|