C8H17ClN2O2S — CID 119280656
N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119280656) has the molecular formula C8H17ClN2O2S and a molecular weight of 240.76 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119280656 |
| Molecular Formula | C8H17ClN2O2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CCOCCNC(=O)C1CSCN1.Cl |
| InChI | InChI=1S/C8H16N2O2S.ClH/c1-2-12-4-3-9-8(11)7-5-13-6-10-7;/h7,10H,2-6H2,1H3,(H,9,11);1H |
| InChIKey | KCHRGNIGAWNHSD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|