C8H16ClN3O2S — CID 119268318
(4S)-N-(2-acetamidoethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119268318) has the molecular formula C8H16ClN3O2S and a molecular weight of 253.75 g/mol. Its IUPAC name is (4S)-N-(2-acetamidoethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | (4S)-N-(2-acetamidoethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119268318 |
| Molecular Formula | C8H16ClN3O2S |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4S)-N-(2-acetamidoethyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CC(=O)NCCNC(=O)[C@H]1CSCN1.Cl |
| InChI | InChI=1S/C8H15N3O2S.ClH/c1-6(12)9-2-3-10-8(13)7-4-14-5-11-7;/h7,11H,2-5H2,1H3,(H,9,12)(H,10,13);1H/t7-;/m1./s1 |
| InChIKey | YLLPZXOWRYDZFF-OGFXRTJISA-N |
| XLogP | -0.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|