C7H14N2O2S2 — CID 115734124
N-(2-methylsulfinylethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 115734124) has the molecular formula C7H14N2O2S2 and a molecular weight of 222.33 g/mol. Its IUPAC name is N-(2-methylsulfinylethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-methylsulfinylethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 115734124 |
| Molecular Formula | C7H14N2O2S2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | N-(2-methylsulfinylethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CS(=O)CCNC(=O)C1CSCN1 |
| InChI | InChI=1S/C7H14N2O2S2/c1-13(11)3-2-8-7(10)6-4-12-5-9-6/h6,9H,2-5H2,1H3,(H,8,10) |
| InChIKey | CKYHXZCVTDKJRX-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |