C8H17N3OS — CID 61276051
N-(4-aminobutyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 61276051) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is N-(4-aminobutyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-aminobutyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 61276051 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-(4-aminobutyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | NCCCCNC(=O)C1CSCN1 |
| InChI | InChI=1S/C8H17N3OS/c9-3-1-2-4-10-8(12)7-5-13-6-11-7/h7,11H,1-6,9H2,(H,10,12) |
| InChIKey | SEWWHGRDFMUSIQ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|