C11H21N3O3S — CID 132961566
methyl (2S)-2-amino-6-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]hexanoate (PubChem CID 132961566) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is methyl (2S)-2-amino-6-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]hexanoate.
| Compound Name | methyl (2S)-2-amino-6-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 132961566 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | methyl (2S)-2-amino-6-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]hexanoate |
| SMILES | COC(=O)[C@@H](N)CCCCNC(=O)[C@@H]1CSCN1 |
| InChI | InChI=1S/C11H21N3O3S/c1-17-11(16)8(12)4-2-3-5-13-10(15)9-6-18-7-14-9/h8-9,14H,2-7,12H2,1H3,(H,13,15)/t8-,9-/m0/s1 |
| InChIKey | VQEIPHFTQUKYQO-IUCAKERBSA-N |
| XLogP | -0.56 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|