C9H16N2O3S — CID 119281420
methyl 2-(1,3-thiazolidine-4-carbonylamino)butanoate (PubChem CID 119281420) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is methyl 2-(1,3-thiazolidine-4-carbonylamino)butanoate.
| Compound Name | methyl 2-(1,3-thiazolidine-4-carbonylamino)butanoate |
|---|---|
| PubChem CID | 119281420 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | methyl 2-(1,3-thiazolidine-4-carbonylamino)butanoate |
| SMILES | CCC(NC(=O)C1CSCN1)C(=O)OC |
| InChI | InChI=1S/C9H16N2O3S/c1-3-6(9(13)14-2)11-8(12)7-4-15-5-10-7/h6-7,10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | LPOPTSMDWFGQJD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |